![(5-Bromofuro[2,3-b]pyridin-2-yl)methanol (CAS: 1188990-02-4) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0681681.webp "(5-Bromofuro[2,3-b]pyridin-2-yl)methanol chemical structure")
(5-Bromofuro[2,3-b]pyridin-2-yl)methanol
Catalog No: FT-0681681
CAS No: 1188990-02-4
- Chemical Name: (5-Bromofuro[2,3-b]pyridin-2-yl)methanol
- Molecular Formula: C8H6BrNO2
- Molecular Weight: 228.04 g/mol
- InChI Key: SJASNTWQPIYYBY-UHFFFAOYSA-N
- InChI: InChI=1S/C8H6BrNO2/c9-6-1-5-2-7(4-11)12-8(5)10-3-6/h1-3,11H,4H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 228.04300 |
| Density: | N/A |
| CAS: | 1188990-02-4 |
| Bolling_Point: | N/A |
| Product_Name: | (5-Bromofuro[2,3-b]pyridin-2-yl)methanol |
| Melting_Point: | N/A |
| Flash_Point: | N/A |
| MF: | C8H6BrNO2 |
| LogP: | 2.08260 |
|---|---|
| PSA: | 46.26000 |
| MF: | C8H6BrNO2 |
| FW: | 228.04300 |
| Exact_Mass: | 226.95800 |
| Warning_Statement: | P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
